C23H26F3NO5 — CID 12061741
[(1R,2S)-2-nitro-1-phenylheptyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 12061741) has the molecular formula C23H26F3NO5 and a molecular weight of 453.46 g/mol. Its IUPAC name is [(1R,2S)-2-nitro-1-phenylheptyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1R,2S)-2-nitro-1-phenylheptyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 12061741 |
| Molecular Formula | C23H26F3NO5 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | [(1R,2S)-2-nitro-1-phenylheptyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CCCCC[C@@H]([C@H](OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F)c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C23H26F3NO5/c1-3-4-7-16-19(27(29)30)20(17-12-8-5-9-13-17)32-21(28)22(31-2,23(24,25)26)18-14-10-6-11-15-18/h5-6,8-15,19-20H,3-4,7,16H2,1-2H3/t19-,20+,22-/m0/s1 |
| InChIKey | INJXKDRVMOGGEH-VWPQPMDRSA-N |
| XLogP | 5.60 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|