C32H35NO10 — CID 10930026
dimethyl 2-[(2S,3S,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanedioate (PubChem CID 10930026) has the molecular formula C32H35NO10 and a molecular weight of 593.63 g/mol. Its IUPAC name is dimethyl 2-[(2S,3S,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanedioate.
| Compound Name | dimethyl 2-[(2S,3S,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanedioate |
|---|---|
| PubChem CID | 10930026 |
| Molecular Formula | C32H35NO10 |
| Molecular Weight | 593.63 g/mol |
| Exact Mass | 593.23 |
| IUPAC Name | dimethyl 2-[(2S,3S,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C32H35NO10/c1-38-31(34)26(32(35)39-2)29-27(33(36)37)30(42-20-24-16-10-5-11-17-24)28(41-19-23-14-8-4-9-15-23)25(43-29)21-40-18-22-12-6-3-7-13-22/h3-17,25-30H,18-21H2,1-2H3/t25-,27+,28+,29+,30-/m1/s1 |
| InChIKey | PRVUJVNFZMXTPD-VQXQMPIVSA-N |
| XLogP | 3.75 |
| TPSA | 132.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.63 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|