C34H37NO9 — CID 50917162
methyl 3-[(2S,3R,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-ynoxyoxan-3-yl]propanoate (PubChem CID 50917162) has the molecular formula C34H37NO9 and a molecular weight of 603.67 g/mol. Its IUPAC name is methyl 3-[(2S,3R,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-ynoxyoxan-3-yl]propanoate.
| Compound Name | methyl 3-[(2S,3R,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-ynoxyoxan-3-yl]propanoate |
|---|---|
| PubChem CID | 50917162 |
| Molecular Formula | C34H37NO9 |
| Molecular Weight | 603.67 g/mol |
| Exact Mass | 603.25 |
| IUPAC Name | methyl 3-[(2S,3R,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-ynoxyoxan-3-yl]propanoate |
| SMILES | C#CCO[C@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@]1(CCC(=O)OC)[N+](=O)[O-] |
| InChI | InChI=1S/C34H37NO9/c1-3-21-41-33-34(35(37)38,20-19-30(36)39-2)32(43-24-28-17-11-6-12-18-28)31(42-23-27-15-9-5-10-16-27)29(44-33)25-40-22-26-13-7-4-8-14-26/h1,4-18,29,31-33H,19-25H2,2H3/t29-,31+,32+,33+,34-/m1/s1 |
| InChIKey | UHGVVKFBDJBVHT-LJHWHBDJSA-N |
| XLogP | 4.72 |
| TPSA | 115.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.67 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|