C14H12N2 — CID 12987698
3,8-dimethyl-1,10-phenanthroline (PubChem CID 12987698) has the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 3,8-dimethyl-1,10-phenanthroline.
| Compound Name | 3,8-dimethyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 12987698 |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 3,8-dimethyl-1,10-phenanthroline |
| SMILES | Cc1cnc2c(ccc3cc(C)cnc32)c1 |
| InChI | InChI=1S/C14H12N2/c1-9-5-11-3-4-12-6-10(2)8-16-14(12)13(11)15-7-9/h3-8H,1-2H3 |
| InChIKey | KSACKJIWQPGKMJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|