C14H14N2O3 — CID 12988741
4-(2-methoxybenzoyl)-2,6-dimethylpyridazin-3-one (PubChem CID 12988741) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 4-(2-methoxybenzoyl)-2,6-dimethylpyridazin-3-one.
| Compound Name | 4-(2-methoxybenzoyl)-2,6-dimethylpyridazin-3-one |
|---|---|
| PubChem CID | 12988741 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 4-(2-methoxybenzoyl)-2,6-dimethylpyridazin-3-one |
| SMILES | COc1ccccc1C(=O)c1cc(C)nn(C)c1=O |
| InChI | InChI=1S/C14H14N2O3/c1-9-8-11(14(18)16(2)15-9)13(17)10-6-4-5-7-12(10)19-3/h4-8H,1-3H3 |
| InChIKey | AQMUFPITYMVODM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |