C14H16N2O3 — CID 105098356
(2,5-dimethoxyphenyl)-(2,5-dimethylpyrazol-3-yl)methanone (PubChem CID 105098356) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)-(2,5-dimethylpyrazol-3-yl)methanone.
| Compound Name | (2,5-dimethoxyphenyl)-(2,5-dimethylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 105098356 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (2,5-dimethoxyphenyl)-(2,5-dimethylpyrazol-3-yl)methanone |
| SMILES | COc1ccc(OC)c(C(=O)c2cc(C)nn2C)c1 |
| InChI | InChI=1S/C14H16N2O3/c1-9-7-12(16(2)15-9)14(17)11-8-10(18-3)5-6-13(11)19-4/h5-8H,1-4H3 |
| InChIKey | IFJNTFNIGRVFDX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |