C14H16N2O — CID 105093552
(3,4-dimethylphenyl)-(2,5-dimethylpyrazol-3-yl)methanone (PubChem CID 105093552) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-(2,5-dimethylpyrazol-3-yl)methanone.
| Compound Name | (3,4-dimethylphenyl)-(2,5-dimethylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 105093552 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | (3,4-dimethylphenyl)-(2,5-dimethylpyrazol-3-yl)methanone |
| SMILES | Cc1cc(C(=O)c2ccc(C)c(C)c2)n(C)n1 |
| InChI | InChI=1S/C14H16N2O/c1-9-5-6-12(7-10(9)2)14(17)13-8-11(3)15-16(13)4/h5-8H,1-4H3 |
| InChIKey | NVTDQIHKJPYBJK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |