C15H18N2O3 — CID 114978939
1-(2,4-dimethoxyphenyl)-2-(2,5-dimethylpyrazol-3-yl)ethanone (PubChem CID 114978939) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-2-(2,5-dimethylpyrazol-3-yl)ethanone.
| Compound Name | 1-(2,4-dimethoxyphenyl)-2-(2,5-dimethylpyrazol-3-yl)ethanone |
|---|---|
| PubChem CID | 114978939 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-2-(2,5-dimethylpyrazol-3-yl)ethanone |
| SMILES | COc1ccc(C(=O)Cc2cc(C)nn2C)c(OC)c1 |
| InChI | InChI=1S/C15H18N2O3/c1-10-7-11(17(2)16-10)8-14(18)13-6-5-12(19-3)9-15(13)20-4/h5-7,9H,8H2,1-4H3 |
| InChIKey | NITMBCRCAYAPQP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |