methyl 2-[(2,5-dimethylpyrazol-3-yl)amino]-5-methoxybenzoate

C14H17N3O3 — CID 141175690

IUPACmethyl 2-[(2,5-dimethylpyrazol-3-yl)amino]-5-methoxybenzoate
SMILESCOC(=O)c1cc(OC)ccc1Nc1cc(C)nn1C
InChIInChI=1S/C14H17N3O3/c1-9-7-13(17(2)16-9)15-12-6-5-10(19-3)8-11(12)14(18)20-4/h5-8,15H,1-4H3
InChIKeyPJKKAFVHPWKWSZ-UHFFFAOYSA-N
MW275.31 g/mol
LogP2.27
Rot. Bonds4

About methyl 2-[(2,5-dimethylpyrazol-3-yl)amino]-5-methoxybenzoate

methyl 2-[(2,5-dimethylpyrazol-3-yl)amino]-5-methoxybenzoate (PubChem CID 141175690) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is methyl 2-[(2,5-dimethylpyrazol-3-yl)amino]-5-methoxybenzoate.

Molecular Properties

Compound Namemethyl 2-[(2,5-dimethylpyrazol-3-yl)amino]-5-methoxybenzoate
PubChem CID141175690
Molecular FormulaC14H17N3O3
Molecular Weight275.31 g/mol
Exact Mass275.13
IUPAC Namemethyl 2-[(2,5-dimethylpyrazol-3-yl)amino]-5-methoxybenzoate
SMILESCOC(=O)c1cc(OC)ccc1Nc1cc(C)nn1C
InChIInChI=1S/C14H17N3O3/c1-9-7-13(17(2)16-9)15-12-6-5-10(19-3)8-11(12)14(18)20-4/h5-8,15H,1-4H3
InChIKeyPJKKAFVHPWKWSZ-UHFFFAOYSA-N
XLogP2.27
TPSA65.38 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.31
LogP ≤ 52.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 2-[(2,5-dimethylpyrazol-3-yl)amino]-5-methoxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(2,5-dimethylpyrazol-3-yl)amino]-5-methoxybenzoate?
The IUPAC name of methyl 2-[(2,5-dimethylpyrazol-3-yl)amino]-5-methoxybenzoate (CID 141175690) is methyl 2-[(2,5-dimethylpyrazol-3-yl)amino]-5-methoxybenzoate.
What is the SMILES notation for methyl 2-[(2,5-dimethylpyrazol-3-yl)amino]-5-methoxybenzoate?
The canonical SMILES for methyl 2-[(2,5-dimethylpyrazol-3-yl)amino]-5-methoxybenzoate is COC(=O)c1cc(OC)ccc1Nc1cc(C)nn1C.
What is the InChIKey of methyl 2-[(2,5-dimethylpyrazol-3-yl)amino]-5-methoxybenzoate?
The InChIKey is PJKKAFVHPWKWSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O3/c1-9-7-13(17(2)16-9)15-12-6-5-10(19-3)8-11(12)14(18)20-4/h5-8,15H,1-4H3.
What are the key properties of methyl 2-[(2,5-dimethylpyrazol-3-yl)amino]-5-methoxybenzoate?
methyl 2-[(2,5-dimethylpyrazol-3-yl)amino]-5-methoxybenzoate has a molecular weight of 275.31 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2,5-dimethylpyrazol-3-yl)amino]-5-methoxybenzoate is sourced from PubChem (CID 141175690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).