C35H36N4O3 — CID 12989395
2,6-bis[[(2-hydroxyphenyl)methyl-(pyridin-2-ylmethyl)amino]methyl]-4-methylphenol (PubChem CID 12989395) has the molecular formula C35H36N4O3 and a molecular weight of 560.70 g/mol. Its IUPAC name is 2,6-bis[[(2-hydroxyphenyl)methyl-(pyridin-2-ylmethyl)amino]methyl]-4-methylphenol.
| Compound Name | 2,6-bis[[(2-hydroxyphenyl)methyl-(pyridin-2-ylmethyl)amino]methyl]-4-methylphenol |
|---|---|
| PubChem CID | 12989395 |
| Molecular Formula | C35H36N4O3 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | 2,6-bis[[(2-hydroxyphenyl)methyl-(pyridin-2-ylmethyl)amino]methyl]-4-methylphenol |
| SMILES | Cc1cc(CN(Cc2ccccn2)Cc2ccccc2O)c(O)c(CN(Cc2ccccn2)Cc2ccccc2O)c1 |
| InChI | InChI=1S/C35H36N4O3/c1-26-18-29(22-38(24-31-12-6-8-16-36-31)20-27-10-2-4-14-33(27)40)35(42)30(19-26)23-39(25-32-13-7-9-17-37-32)21-28-11-3-5-15-34(28)41/h2-19,40-42H,20-25H2,1H3 |
| InChIKey | ZIQQFNNYGZDLFV-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|