C25H36N4O — CID 135971346
4-(3,6-dimethylpyrazin-2-yl)-2-[[(1-piperidin-1-ylcyclohexyl)methylamino]methyl]phenol (PubChem CID 135971346) has the molecular formula C25H36N4O and a molecular weight of 408.59 g/mol. Its IUPAC name is 4-(3,6-dimethylpyrazin-2-yl)-2-[[(1-piperidin-1-ylcyclohexyl)methylamino]methyl]phenol.
| Compound Name | 4-(3,6-dimethylpyrazin-2-yl)-2-[[(1-piperidin-1-ylcyclohexyl)methylamino]methyl]phenol |
|---|---|
| PubChem CID | 135971346 |
| Molecular Formula | C25H36N4O |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | 4-(3,6-dimethylpyrazin-2-yl)-2-[[(1-piperidin-1-ylcyclohexyl)methylamino]methyl]phenol |
| SMILES | Cc1cnc(C)c(-c2ccc(O)c(CNCC3(N4CCCCC4)CCCCC3)c2)n1 |
| InChI | InChI=1S/C25H36N4O/c1-19-16-27-20(2)24(28-19)21-9-10-23(30)22(15-21)17-26-18-25(11-5-3-6-12-25)29-13-7-4-8-14-29/h9-10,15-16,26,30H,3-8,11-14,17-18H2,1-2H3 |
| InChIKey | CTKQBQBYWHSEAI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|