C28H21P — CID 12990043
13-(2,3,4,5,6-pentadeuteriophenyl)-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene (PubChem CID 12990043) has the molecular formula C28H21P and a molecular weight of 393.48 g/mol. Its IUPAC name is 13-(2,3,4,5,6-pentadeuteriophenyl)-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene.
| Compound Name | 13-(2,3,4,5,6-pentadeuteriophenyl)-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
|---|---|
| PubChem CID | 12990043 |
| Molecular Formula | C28H21P |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 13-(2,3,4,5,6-pentadeuteriophenyl)-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
| SMILES | [2H]c1c([2H])c([2H])c(P2Cc3ccc4ccccc4c3-c3c(ccc4ccccc34)C2)c([2H])c1[2H] |
| InChI | InChI=1S/C28H21P/c1-2-10-24(11-3-1)29-18-22-16-14-20-8-4-6-12-25(20)27(22)28-23(19-29)17-15-21-9-5-7-13-26(21)28/h1-17H,18-19H2/i1D,2D,3D,10D,11D |
| InChIKey | NHIVGNHRQMUGNK-PDNVFQDQSA-N |
| XLogP | 7.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|