C25H31NO4Se — CID 12991813
(1S,4R)-4,7,7-trimethyl-3-oxo-N-(3-oxocyclopenten-1-yl)-N-(4-phenylselanylbutyl)-2-oxabicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 12991813) has the molecular formula C25H31NO4Se and a molecular weight of 488.49 g/mol. Its IUPAC name is (1S,4R)-4,7,7-trimethyl-3-oxo-N-(3-oxocyclopenten-1-yl)-N-(4-phenylselanylbutyl)-2-oxabicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1S,4R)-4,7,7-trimethyl-3-oxo-N-(3-oxocyclopenten-1-yl)-N-(4-phenylselanylbutyl)-2-oxabicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 12991813 |
| Molecular Formula | C25H31NO4Se |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | (1S,4R)-4,7,7-trimethyl-3-oxo-N-(3-oxocyclopenten-1-yl)-N-(4-phenylselanylbutyl)-2-oxabicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC1(C)[C@@]2(C)CC[C@]1(C(=O)N(CCCC[Se]c1ccccc1)C1=CC(=O)CC1)OC2=O |
| InChI | InChI=1S/C25H31NO4Se/c1-23(2)24(3)13-14-25(23,30-22(24)29)21(28)26(18-11-12-19(27)17-18)15-7-8-16-31-20-9-5-4-6-10-20/h4-6,9-10,17H,7-8,11-16H2,1-3H3/t24-,25+/m0/s1 |
| InChIKey | IFZVDRJVVLNFLC-LOSJGSFVSA-N |
| XLogP | 3.41 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|