C18H22FNO4 — CID 12991915
tert-butyl N-[(Z,2R)-3-fluoro-4-[(3R)-2-oxooxetan-3-yl]-1-phenylbut-3-en-2-yl]carbamate (PubChem CID 12991915) has the molecular formula C18H22FNO4 and a molecular weight of 335.38 g/mol. Its IUPAC name is tert-butyl N-[(Z,2R)-3-fluoro-4-[(3R)-2-oxooxetan-3-yl]-1-phenylbut-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(Z,2R)-3-fluoro-4-[(3R)-2-oxooxetan-3-yl]-1-phenylbut-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 12991915 |
| Molecular Formula | C18H22FNO4 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | tert-butyl N-[(Z,2R)-3-fluoro-4-[(3R)-2-oxooxetan-3-yl]-1-phenylbut-3-en-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccccc1)/C(F)=C/[C@@H]1COC1=O |
| InChI | InChI=1S/C18H22FNO4/c1-18(2,3)24-17(22)20-15(9-12-7-5-4-6-8-12)14(19)10-13-11-23-16(13)21/h4-8,10,13,15H,9,11H2,1-3H3,(H,20,22)/b14-10-/t13-,15-/m1/s1 |
| InChIKey | DENUIDLSTMNXJR-CLPJTPEWSA-N |
| XLogP | 3.15 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|