C19H22N2O — CID 12994070
2-(2-methoxy-3,3-dimethylbutan-2-yl)-1,10-phenanthroline (PubChem CID 12994070) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-(2-methoxy-3,3-dimethylbutan-2-yl)-1,10-phenanthroline.
| Compound Name | 2-(2-methoxy-3,3-dimethylbutan-2-yl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 12994070 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-(2-methoxy-3,3-dimethylbutan-2-yl)-1,10-phenanthroline |
| SMILES | COC(C)(c1ccc2ccc3cccnc3c2n1)C(C)(C)C |
| InChI | InChI=1S/C19H22N2O/c1-18(2,3)19(4,22-5)15-11-10-14-9-8-13-7-6-12-20-16(13)17(14)21-15/h6-12H,1-5H3 |
| InChIKey | YMDPAWJWNAMUQZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|