C15H21NO2 — CID 12994986
(3S)-2-tert-butyl-4,4-dimethyl-3-phenyl-1,2-oxazolidin-5-one (PubChem CID 12994986) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is (3S)-2-tert-butyl-4,4-dimethyl-3-phenyl-1,2-oxazolidin-5-one.
| Compound Name | (3S)-2-tert-butyl-4,4-dimethyl-3-phenyl-1,2-oxazolidin-5-one |
|---|---|
| PubChem CID | 12994986 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (3S)-2-tert-butyl-4,4-dimethyl-3-phenyl-1,2-oxazolidin-5-one |
| SMILES | CC1(C)C(=O)ON(C(C)(C)C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H21NO2/c1-14(2,3)16-12(11-9-7-6-8-10-11)15(4,5)13(17)18-16/h6-10,12H,1-5H3/t12-/m0/s1 |
| InChIKey | XTXMYCXCRMECJG-LBPRGKRZSA-N |
| XLogP | 3.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |