C20H18BrNO2 — CID 1299627
2-(1-bromonaphthalen-2-yl)oxy-N-(2,3-dimethylphenyl)acetamide (PubChem CID 1299627) has the molecular formula C20H18BrNO2 and a molecular weight of 384.27 g/mol. Its IUPAC name is 2-(1-bromonaphthalen-2-yl)oxy-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-(1-bromonaphthalen-2-yl)oxy-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 1299627 |
| Molecular Formula | C20H18BrNO2 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 2-(1-bromonaphthalen-2-yl)oxy-N-(2,3-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)COc2ccc3ccccc3c2Br)c1C |
| InChI | InChI=1S/C20H18BrNO2/c1-13-6-5-9-17(14(13)2)22-19(23)12-24-18-11-10-15-7-3-4-8-16(15)20(18)21/h3-11H,12H2,1-2H3,(H,22,23) |
| InChIKey | NFRJPLHPJPAGPL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |