C32H27NO7 — CID 12997022
methyl 2-[2-hydroxy-4-(4-methoxybenzoyl)-5-(4-methoxyphenyl)-1-naphthalen-1-yl-3-oxopyrrol-2-yl]acetate (PubChem CID 12997022) has the molecular formula C32H27NO7 and a molecular weight of 537.57 g/mol. Its IUPAC name is methyl 2-[2-hydroxy-4-(4-methoxybenzoyl)-5-(4-methoxyphenyl)-1-naphthalen-1-yl-3-oxopyrrol-2-yl]acetate.
| Compound Name | methyl 2-[2-hydroxy-4-(4-methoxybenzoyl)-5-(4-methoxyphenyl)-1-naphthalen-1-yl-3-oxopyrrol-2-yl]acetate |
|---|---|
| PubChem CID | 12997022 |
| Molecular Formula | C32H27NO7 |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | methyl 2-[2-hydroxy-4-(4-methoxybenzoyl)-5-(4-methoxyphenyl)-1-naphthalen-1-yl-3-oxopyrrol-2-yl]acetate |
| SMILES | COC(=O)CC1(O)C(=O)C(C(=O)c2ccc(OC)cc2)=C(c2ccc(OC)cc2)N1c1cccc2ccccc12 |
| InChI | InChI=1S/C32H27NO7/c1-38-23-15-11-21(12-16-23)29-28(30(35)22-13-17-24(39-2)18-14-22)31(36)32(37,19-27(34)40-3)33(29)26-10-6-8-20-7-4-5-9-25(20)26/h4-18,37H,19H2,1-3H3 |
| InChIKey | VVLQRYPOYAOLJB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|