C16H23NO3S — CID 12997090
N-[(1S,2R)-2-butyl-4-oxocyclobutyl]-N,4-dimethylbenzenesulfonamide (PubChem CID 12997090) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is N-[(1S,2R)-2-butyl-4-oxocyclobutyl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[(1S,2R)-2-butyl-4-oxocyclobutyl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 12997090 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | N-[(1S,2R)-2-butyl-4-oxocyclobutyl]-N,4-dimethylbenzenesulfonamide |
| SMILES | CCCC[C@@H]1CC(=O)[C@H]1N(C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H23NO3S/c1-4-5-6-13-11-15(18)16(13)17(3)21(19,20)14-9-7-12(2)8-10-14/h7-10,13,16H,4-6,11H2,1-3H3/t13-,16+/m1/s1 |
| InChIKey | YBWBEAMDGPVONI-CJNGLKHVSA-N |
| XLogP | 2.76 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |