C16H19NO3S — CID 139254732
N,4-dimethyl-N-[(2R)-3-oxo-2-bicyclo[2.2.2]oct-5-enyl]benzenesulfonamide (PubChem CID 139254732) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is N,4-dimethyl-N-[(2R)-3-oxo-2-bicyclo[2.2.2]oct-5-enyl]benzenesulfonamide.
| Compound Name | N,4-dimethyl-N-[(2R)-3-oxo-2-bicyclo[2.2.2]oct-5-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 139254732 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | N,4-dimethyl-N-[(2R)-3-oxo-2-bicyclo[2.2.2]oct-5-enyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)[C@H]2C(=O)C3C=CC2CC3)cc1 |
| InChI | InChI=1S/C16H19NO3S/c1-11-3-9-14(10-4-11)21(19,20)17(2)15-12-5-7-13(8-6-12)16(15)18/h3-5,7,9-10,12-13,15H,6,8H2,1-2H3/t12?,13?,15-/m1/s1 |
| InChIKey | XANWMTHXAOPQBY-SSDMNJCBSA-N |
| XLogP | 2.15 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|