C13H21NO3 — CID 130003514
tert-butyl 3-hydroxy-2,3,5,6,7,7a-hexahydroindole-1-carboxylate (PubChem CID 130003514) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-2,3,5,6,7,7a-hexahydroindole-1-carboxylate.
| Compound Name | tert-butyl 3-hydroxy-2,3,5,6,7,7a-hexahydroindole-1-carboxylate |
|---|---|
| PubChem CID | 130003514 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | tert-butyl 3-hydroxy-2,3,5,6,7,7a-hexahydroindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(O)C2=CCCCC21 |
| InChI | InChI=1S/C13H21NO3/c1-13(2,3)17-12(16)14-8-11(15)9-6-4-5-7-10(9)14/h6,10-11,15H,4-5,7-8H2,1-3H3 |
| InChIKey | FQXNXNRRZBDXGG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|