C9H16N2O3 — CID 130007322
1-cyclohexyl-4,5-dihydroxyimidazolidin-2-one (PubChem CID 130007322) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 1-cyclohexyl-4,5-dihydroxyimidazolidin-2-one.
| Compound Name | 1-cyclohexyl-4,5-dihydroxyimidazolidin-2-one |
|---|---|
| PubChem CID | 130007322 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 1-cyclohexyl-4,5-dihydroxyimidazolidin-2-one |
| SMILES | O=C1NC(O)C(O)N1C1CCCCC1 |
| InChI | InChI=1S/C9H16N2O3/c12-7-8(13)11(9(14)10-7)6-4-2-1-3-5-6/h6-8,12-13H,1-5H2,(H,10,14) |
| InChIKey | LPPIKBLYAOLOJP-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |