C12H17N3O — CID 130007921
N'-benzylpyrrolidine-2-carbohydrazide (PubChem CID 130007921) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is N'-benzylpyrrolidine-2-carbohydrazide.
| Compound Name | N'-benzylpyrrolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 130007921 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | N'-benzylpyrrolidine-2-carbohydrazide |
| SMILES | O=C(NNCc1ccccc1)C1CCCN1 |
| InChI | InChI=1S/C12H17N3O/c16-12(11-7-4-8-13-11)15-14-9-10-5-2-1-3-6-10/h1-3,5-6,11,13-14H,4,7-9H2,(H,15,16) |
| InChIKey | IEPALTQLRGRHRL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|