C12H17N3O — CID 124707340
(2R)-N'-phenylpiperidine-2-carbohydrazide (PubChem CID 124707340) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is (2R)-N'-phenylpiperidine-2-carbohydrazide.
| Compound Name | (2R)-N'-phenylpiperidine-2-carbohydrazide |
|---|---|
| PubChem CID | 124707340 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | (2R)-N'-phenylpiperidine-2-carbohydrazide |
| SMILES | O=C(NNc1ccccc1)[C@H]1CCCCN1 |
| InChI | InChI=1S/C12H17N3O/c16-12(11-8-4-5-9-13-11)15-14-10-6-2-1-3-7-10/h1-3,6-7,11,13-14H,4-5,8-9H2,(H,15,16)/t11-/m1/s1 |
| InChIKey | MQARDQCYLATSGA-LLVKDONJSA-N |
| XLogP | 1.27 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|