C8H9N3O2S — CID 130008785
6-methyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-amine (PubChem CID 130008785) has the molecular formula C8H9N3O2S and a molecular weight of 211.25 g/mol. Its IUPAC name is 6-methyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-amine.
| Compound Name | 6-methyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-amine |
|---|---|
| PubChem CID | 130008785 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 6-methyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-amine |
| SMILES | Cc1ccc2c(c1)NC(N)=NS2(=O)=O |
| InChI | InChI=1S/C8H9N3O2S/c1-5-2-3-7-6(4-5)10-8(9)11-14(7,12)13/h2-4H,1H3,(H3,9,10,11) |
| InChIKey | YYQXABQKKAUJBR-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |