C10H9NO3 — CID 130011072
N-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)prop-2-enamide (PubChem CID 130011072) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is N-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)prop-2-enamide.
| Compound Name | N-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 130011072 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | N-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)prop-2-enamide |
| SMILES | C=CC(=O)NC1=CC(=O)C(C)=CC1=O |
| InChI | InChI=1S/C10H9NO3/c1-3-10(14)11-7-5-8(12)6(2)4-9(7)13/h3-5H,1H2,2H3,(H,11,14) |
| InChIKey | XOYSDFBPFAAPDZ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|