C9H14N2O3 — CID 130019670
7-(hydroxymethyl)-3,4,7,8,9,9a-hexahydro-2H-pyrrolo[1,2-a][1,4]diazepine-1,5-dione (PubChem CID 130019670) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 7-(hydroxymethyl)-3,4,7,8,9,9a-hexahydro-2H-pyrrolo[1,2-a][1,4]diazepine-1,5-dione.
| Compound Name | 7-(hydroxymethyl)-3,4,7,8,9,9a-hexahydro-2H-pyrrolo[1,2-a][1,4]diazepine-1,5-dione |
|---|---|
| PubChem CID | 130019670 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 7-(hydroxymethyl)-3,4,7,8,9,9a-hexahydro-2H-pyrrolo[1,2-a][1,4]diazepine-1,5-dione |
| SMILES | O=C1NCCC(=O)N2C(CO)CCC12 |
| InChI | InChI=1S/C9H14N2O3/c12-5-6-1-2-7-9(14)10-4-3-8(13)11(6)7/h6-7,12H,1-5H2,(H,10,14) |
| InChIKey | NBTDXEDXXITLPT-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |