C10H15NO — CID 130027015
2,4,8-trimethyl-8-azabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 130027015) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 2,4,8-trimethyl-8-azabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | 2,4,8-trimethyl-8-azabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 130027015 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 2,4,8-trimethyl-8-azabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | CC1C(=O)C(C)C2C=CC1N2C |
| InChI | InChI=1S/C10H15NO/c1-6-8-4-5-9(11(8)3)7(2)10(6)12/h4-9H,1-3H3 |
| InChIKey | CGNFANDOMSVQQI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|