C7H10O2 — CID 130028189
2,5-dimethyl-2,3-dihydropyran-4-one (PubChem CID 130028189) has the molecular formula C7H10O2 and a molecular weight of 126.15 g/mol. Its IUPAC name is 2,5-dimethyl-2,3-dihydropyran-4-one.
| Compound Name | 2,5-dimethyl-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 130028189 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | 2,5-dimethyl-2,3-dihydropyran-4-one |
| SMILES | CC1=COC(C)CC1=O |
| InChI | InChI=1S/C7H10O2/c1-5-4-9-6(2)3-7(5)8/h4,6H,3H2,1-2H3 |
| InChIKey | LCYQDSFFNRNNMU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |