C8H12O2 — CID 21286956
2,3,5-trimethyl-2,3-dihydropyran-4-one (PubChem CID 21286956) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is 2,3,5-trimethyl-2,3-dihydropyran-4-one.
| Compound Name | 2,3,5-trimethyl-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 21286956 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 2,3,5-trimethyl-2,3-dihydropyran-4-one |
| SMILES | CC1=COC(C)C(C)C1=O |
| InChI | InChI=1S/C8H12O2/c1-5-4-10-7(3)6(2)8(5)9/h4,6-7H,1-3H3 |
| InChIKey | UIFJGMGRKBEFOU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |