About spiro[2.7]decan-9-one
spiro[2.7]decan-9-one (PubChem CID 130028945) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is spiro[2.7]decan-9-one.
Molecular Properties
| Compound Name | spiro[2.7]decan-9-one |
| PubChem CID | 130028945 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | spiro[2.7]decan-9-one |
| SMILES | O=C1CCCCCC2(CC2)C1 |
| InChI | InChI=1S/C10H16O/c11-9-4-2-1-3-5-10(8-9)6-7-10/h1-8H2 |
| InChIKey | RGBSOIQRDNRRCS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[2.7]decan-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[2.7]decan-9-one?
The IUPAC name of spiro[2.7]decan-9-one (CID 130028945) is spiro[2.7]decan-9-one.
What is the SMILES notation for spiro[2.7]decan-9-one?
The canonical SMILES for spiro[2.7]decan-9-one is O=C1CCCCCC2(CC2)C1.
What is the InChIKey of spiro[2.7]decan-9-one?
The InChIKey is RGBSOIQRDNRRCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O/c11-9-4-2-1-3-5-10(8-9)6-7-10/h1-8H2.
What are the key properties of spiro[2.7]decan-9-one?
spiro[2.7]decan-9-one has a molecular weight of 152.24 g/mol, XLogP of 2.69, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2.7]decan-9-one is sourced from PubChem (CID 130028945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).