C9H12O2 — CID 130030576
1-hydroxy-4-methylbicyclo[3.2.1]oct-3-en-2-one (PubChem CID 130030576) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 1-hydroxy-4-methylbicyclo[3.2.1]oct-3-en-2-one.
| Compound Name | 1-hydroxy-4-methylbicyclo[3.2.1]oct-3-en-2-one |
|---|---|
| PubChem CID | 130030576 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 1-hydroxy-4-methylbicyclo[3.2.1]oct-3-en-2-one |
| SMILES | CC1=CC(=O)C2(O)CCC1C2 |
| InChI | InChI=1S/C9H12O2/c1-6-4-8(10)9(11)3-2-7(6)5-9/h4,7,11H,2-3,5H2,1H3 |
| InChIKey | CLSDMSTZVXISDO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |