C12H16O2 — CID 24905795
(3aR,6R,6aS)-6a-hydroxy-3-methyl-6-prop-1-en-2-yl-3a,4,5,6-tetrahydropentalen-1-one (PubChem CID 24905795) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (3aR,6R,6aS)-6a-hydroxy-3-methyl-6-prop-1-en-2-yl-3a,4,5,6-tetrahydropentalen-1-one.
| Compound Name | (3aR,6R,6aS)-6a-hydroxy-3-methyl-6-prop-1-en-2-yl-3a,4,5,6-tetrahydropentalen-1-one |
|---|---|
| PubChem CID | 24905795 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (3aR,6R,6aS)-6a-hydroxy-3-methyl-6-prop-1-en-2-yl-3a,4,5,6-tetrahydropentalen-1-one |
| SMILES | C=C(C)[C@H]1CC[C@@H]2C(C)=CC(=O)[C@]12O |
| InChI | InChI=1S/C12H16O2/c1-7(2)9-4-5-10-8(3)6-11(13)12(9,10)14/h6,9-10,14H,1,4-5H2,2-3H3/t9-,10-,12+/m1/s1 |
| InChIKey | GORODXJJPFMTNN-FOGDFJRCSA-N |
| XLogP | 1.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|