C9H8O3 — CID 130031433
1-oxaspiro[4.5]deca-7,9-diene-2,6-dione (PubChem CID 130031433) has the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. Its IUPAC name is 1-oxaspiro[4.5]deca-7,9-diene-2,6-dione.
| Compound Name | 1-oxaspiro[4.5]deca-7,9-diene-2,6-dione |
|---|---|
| PubChem CID | 130031433 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 1-oxaspiro[4.5]deca-7,9-diene-2,6-dione |
| SMILES | O=C1CCC2(C=CC=CC2=O)O1 |
| InChI | InChI=1S/C9H8O3/c10-7-3-1-2-5-9(7)6-4-8(11)12-9/h1-3,5H,4,6H2 |
| InChIKey | IXHKXHKRRUDDSW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |