C12H25N — CID 130039908
(1S)-1-cyclohexyl-3,3-dimethylbutan-1-amine (PubChem CID 130039908) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is (1S)-1-cyclohexyl-3,3-dimethylbutan-1-amine.
| Compound Name | (1S)-1-cyclohexyl-3,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 130039908 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | (1S)-1-cyclohexyl-3,3-dimethylbutan-1-amine |
| SMILES | CC(C)(C)C[C@H](N)C1CCCCC1 |
| InChI | InChI=1S/C12H25N/c1-12(2,3)9-11(13)10-7-5-4-6-8-10/h10-11H,4-9,13H2,1-3H3/t11-/m0/s1 |
| InChIKey | CXKMLWQWPOBTET-NSHDSACASA-N |
| XLogP | 3.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |