C10H11Br2NO — CID 130043119
2-(2,4-dibromo-5-methoxyphenyl)azetidine (PubChem CID 130043119) has the molecular formula C10H11Br2NO and a molecular weight of 321.01 g/mol. Its IUPAC name is 2-(2,4-dibromo-5-methoxyphenyl)azetidine.
| Compound Name | 2-(2,4-dibromo-5-methoxyphenyl)azetidine |
|---|---|
| PubChem CID | 130043119 |
| Molecular Formula | C10H11Br2NO |
| Molecular Weight | 321.01 g/mol |
| Exact Mass | 318.92 |
| IUPAC Name | 2-(2,4-dibromo-5-methoxyphenyl)azetidine |
| SMILES | COc1cc(C2CCN2)c(Br)cc1Br |
| InChI | InChI=1S/C10H11Br2NO/c1-14-10-4-6(9-2-3-13-9)7(11)5-8(10)12/h4-5,9,13H,2-3H2,1H3 |
| InChIKey | OGRUHYOMXNJXDP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.01 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |