C12H17BrClNO2 — CID 171196222
(2S)-2-(2-bromo-4,5-dimethoxyphenyl)pyrrolidine;hydrochloride (PubChem CID 171196222) has the molecular formula C12H17BrClNO2 and a molecular weight of 322.63 g/mol. Its IUPAC name is (2S)-2-(2-bromo-4,5-dimethoxyphenyl)pyrrolidine;hydrochloride.
| Compound Name | (2S)-2-(2-bromo-4,5-dimethoxyphenyl)pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 171196222 |
| Molecular Formula | C12H17BrClNO2 |
| Molecular Weight | 322.63 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | (2S)-2-(2-bromo-4,5-dimethoxyphenyl)pyrrolidine;hydrochloride |
| SMILES | COc1cc(Br)c([C@@H]2CCCN2)cc1OC.Cl |
| InChI | InChI=1S/C12H16BrNO2.ClH/c1-15-11-6-8(10-4-3-5-14-10)9(13)7-12(11)16-2;/h6-7,10,14H,3-5H2,1-2H3;1H/t10-;/m0./s1 |
| InChIKey | YVQXJGZIINGZAW-PPHPATTJSA-N |
| XLogP | 3.31 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.63 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |