C11H13Br2NO — CID 3973161
2-(3,5-dibromo-2-methoxyphenyl)pyrrolidine (PubChem CID 3973161) has the molecular formula C11H13Br2NO and a molecular weight of 335.04 g/mol. Its IUPAC name is 2-(3,5-dibromo-2-methoxyphenyl)pyrrolidine.
| Compound Name | 2-(3,5-dibromo-2-methoxyphenyl)pyrrolidine |
|---|---|
| PubChem CID | 3973161 |
| Molecular Formula | C11H13Br2NO |
| Molecular Weight | 335.04 g/mol |
| Exact Mass | 332.94 |
| IUPAC Name | 2-(3,5-dibromo-2-methoxyphenyl)pyrrolidine |
| SMILES | COc1c(Br)cc(Br)cc1C1CCCN1 |
| InChI | InChI=1S/C11H13Br2NO/c1-15-11-8(10-3-2-4-14-10)5-7(12)6-9(11)13/h5-6,10,14H,2-4H2,1H3 |
| InChIKey | IFBDNNOGEKEIFD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.04 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |