C10H11NOS2 — CID 13005196
3-(3-methylphenyl)-2-sulfanyl-1,3-thiazolidin-4-one (PubChem CID 13005196) has the molecular formula C10H11NOS2 and a molecular weight of 225.34 g/mol. Its IUPAC name is 3-(3-methylphenyl)-2-sulfanyl-1,3-thiazolidin-4-one.
| Compound Name | 3-(3-methylphenyl)-2-sulfanyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 13005196 |
| Molecular Formula | C10H11NOS2 |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | 3-(3-methylphenyl)-2-sulfanyl-1,3-thiazolidin-4-one |
| SMILES | Cc1cccc(N2C(=O)CSC2S)c1 |
| InChI | InChI=1S/C10H11NOS2/c1-7-3-2-4-8(5-7)11-9(12)6-14-10(11)13/h2-5,10,13H,6H2,1H3 |
| InChIKey | ULCCJFKVNXTDHJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|