C20H14Cl2O4 — CID 13005616
1,4-bis(2-chloroprop-2-enoxy)anthracene-9,10-dione (PubChem CID 13005616) has the molecular formula C20H14Cl2O4 and a molecular weight of 389.23 g/mol. Its IUPAC name is 1,4-bis(2-chloroprop-2-enoxy)anthracene-9,10-dione.
| Compound Name | 1,4-bis(2-chloroprop-2-enoxy)anthracene-9,10-dione |
|---|---|
| PubChem CID | 13005616 |
| Molecular Formula | C20H14Cl2O4 |
| Molecular Weight | 389.23 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | 1,4-bis(2-chloroprop-2-enoxy)anthracene-9,10-dione |
| SMILES | C=C(Cl)COc1ccc(OCC(=C)Cl)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H14Cl2O4/c1-11(21)9-25-15-7-8-16(26-10-12(2)22)18-17(15)19(23)13-5-3-4-6-14(13)20(18)24/h3-8H,1-2,9-10H2 |
| InChIKey | DKSJRBGDQGTUOY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.23 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|