C8H7F2NO — CID 130057394
5-cyclopropyloxy-2,3-difluoropyridine (PubChem CID 130057394) has the molecular formula C8H7F2NO and a molecular weight of 171.15 g/mol. Its IUPAC name is 5-cyclopropyloxy-2,3-difluoropyridine.
| Compound Name | 5-cyclopropyloxy-2,3-difluoropyridine |
|---|---|
| PubChem CID | 130057394 |
| Molecular Formula | C8H7F2NO |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 5-cyclopropyloxy-2,3-difluoropyridine |
| SMILES | Fc1cc(OC2CC2)cnc1F |
| InChI | InChI=1S/C8H7F2NO/c9-7-3-6(4-11-8(7)10)12-5-1-2-5/h3-5H,1-2H2 |
| InChIKey | DSWGOUORQVUFIW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|