C9H8Br2N2 — CID 130059031
2-amino-2-(3,5-dibromophenyl)propanenitrile (PubChem CID 130059031) has the molecular formula C9H8Br2N2 and a molecular weight of 303.99 g/mol. Its IUPAC name is 2-amino-2-(3,5-dibromophenyl)propanenitrile.
| Compound Name | 2-amino-2-(3,5-dibromophenyl)propanenitrile |
|---|---|
| PubChem CID | 130059031 |
| Molecular Formula | C9H8Br2N2 |
| Molecular Weight | 303.99 g/mol |
| Exact Mass | 301.91 |
| IUPAC Name | 2-amino-2-(3,5-dibromophenyl)propanenitrile |
| SMILES | CC(N)(C#N)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C9H8Br2N2/c1-9(13,5-12)6-2-7(10)4-8(11)3-6/h2-4H,13H2,1H3 |
| InChIKey | VTQDPWWMBUUVJR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.99 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |