C10H12N2O — CID 130061052
2-amino-2-(5-ethyl-2-hydroxyphenyl)acetonitrile (PubChem CID 130061052) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-amino-2-(5-ethyl-2-hydroxyphenyl)acetonitrile.
| Compound Name | 2-amino-2-(5-ethyl-2-hydroxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 130061052 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 2-amino-2-(5-ethyl-2-hydroxyphenyl)acetonitrile |
| SMILES | CCc1ccc(O)c(C(N)C#N)c1 |
| InChI | InChI=1S/C10H12N2O/c1-2-7-3-4-10(13)8(5-7)9(12)6-11/h3-5,9,13H,2,12H2,1H3 |
| InChIKey | OJEDSWSRTNEADI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|