C9H6N2O — CID 130063899
4-methyl-1,2-benzoxazole-6-carbonitrile (PubChem CID 130063899) has the molecular formula C9H6N2O and a molecular weight of 158.16 g/mol. Its IUPAC name is 4-methyl-1,2-benzoxazole-6-carbonitrile.
| Compound Name | 4-methyl-1,2-benzoxazole-6-carbonitrile |
|---|---|
| PubChem CID | 130063899 |
| Molecular Formula | C9H6N2O |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 4-methyl-1,2-benzoxazole-6-carbonitrile |
| SMILES | Cc1cc(C#N)cc2oncc12 |
| InChI | InChI=1S/C9H6N2O/c1-6-2-7(4-10)3-9-8(6)5-11-12-9/h2-3,5H,1H3 |
| InChIKey | NRVSZFCHTHZFIW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |