C16H18N2OS — CID 22103403
3,5-dimethyl-4-[3-(2-methyl-1,3-thiazol-5-yl)propoxy]benzonitrile (PubChem CID 22103403) has the molecular formula C16H18N2OS and a molecular weight of 286.40 g/mol. Its IUPAC name is 3,5-dimethyl-4-[3-(2-methyl-1,3-thiazol-5-yl)propoxy]benzonitrile.
| Compound Name | 3,5-dimethyl-4-[3-(2-methyl-1,3-thiazol-5-yl)propoxy]benzonitrile |
|---|---|
| PubChem CID | 22103403 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 3,5-dimethyl-4-[3-(2-methyl-1,3-thiazol-5-yl)propoxy]benzonitrile |
| SMILES | Cc1ncc(CCCOc2c(C)cc(C#N)cc2C)s1 |
| InChI | InChI=1S/C16H18N2OS/c1-11-7-14(9-17)8-12(2)16(11)19-6-4-5-15-10-18-13(3)20-15/h7-8,10H,4-6H2,1-3H3 |
| InChIKey | KAYKWQOUGXLJCP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|