C8H6BrNO — CID 130063933
7-bromo-6-methyl-1,2-benzoxazole (PubChem CID 130063933) has the molecular formula C8H6BrNO and a molecular weight of 212.05 g/mol. Its IUPAC name is 7-bromo-6-methyl-1,2-benzoxazole.
| Compound Name | 7-bromo-6-methyl-1,2-benzoxazole |
|---|---|
| PubChem CID | 130063933 |
| Molecular Formula | C8H6BrNO |
| Molecular Weight | 212.05 g/mol |
| Exact Mass | 210.96 |
| IUPAC Name | 7-bromo-6-methyl-1,2-benzoxazole |
| SMILES | Cc1ccc2cnoc2c1Br |
| InChI | InChI=1S/C8H6BrNO/c1-5-2-3-6-4-10-11-8(6)7(5)9/h2-4H,1H3 |
| InChIKey | AGJMYBGYWPWWFI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.05 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |