C8H6BrFN2O — CID 130065270
(3-bromo-8-fluoroimidazo[1,2-a]pyridin-7-yl)methanol (PubChem CID 130065270) has the molecular formula C8H6BrFN2O and a molecular weight of 245.05 g/mol. Its IUPAC name is (3-bromo-8-fluoroimidazo[1,2-a]pyridin-7-yl)methanol.
| Compound Name | (3-bromo-8-fluoroimidazo[1,2-a]pyridin-7-yl)methanol |
|---|---|
| PubChem CID | 130065270 |
| Molecular Formula | C8H6BrFN2O |
| Molecular Weight | 245.05 g/mol |
| Exact Mass | 243.96 |
| IUPAC Name | (3-bromo-8-fluoroimidazo[1,2-a]pyridin-7-yl)methanol |
| SMILES | OCc1ccn2c(Br)cnc2c1F |
| InChI | InChI=1S/C8H6BrFN2O/c9-6-3-11-8-7(10)5(4-13)1-2-12(6)8/h1-3,13H,4H2 |
| InChIKey | QIOIGSHJBCUBFU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.05 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |