C11H15FN2 — CID 156651605
ethane;8-fluoro-3,7-dimethylimidazo[1,2-a]pyridine (PubChem CID 156651605) has the molecular formula C11H15FN2 and a molecular weight of 194.25 g/mol. Its IUPAC name is ethane;8-fluoro-3,7-dimethylimidazo[1,2-a]pyridine.
| Compound Name | ethane;8-fluoro-3,7-dimethylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 156651605 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | ethane;8-fluoro-3,7-dimethylimidazo[1,2-a]pyridine |
| SMILES | CC.Cc1ccn2c(C)cnc2c1F |
| InChI | InChI=1S/C9H9FN2.C2H6/c1-6-3-4-12-7(2)5-11-9(12)8(6)10;1-2/h3-5H,1-2H3;1-2H3 |
| InChIKey | ZRDPYZWBFSHNCD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |