C14H10F2IN3 — CID 141113254
8-fluoro-N-(2-fluoro-4-methylphenyl)-3-iodoimidazo[1,2-a]pyridin-7-amine (PubChem CID 141113254) has the molecular formula C14H10F2IN3 and a molecular weight of 385.16 g/mol. Its IUPAC name is 8-fluoro-N-(2-fluoro-4-methylphenyl)-3-iodoimidazo[1,2-a]pyridin-7-amine.
| Compound Name | 8-fluoro-N-(2-fluoro-4-methylphenyl)-3-iodoimidazo[1,2-a]pyridin-7-amine |
|---|---|
| PubChem CID | 141113254 |
| Molecular Formula | C14H10F2IN3 |
| Molecular Weight | 385.16 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | 8-fluoro-N-(2-fluoro-4-methylphenyl)-3-iodoimidazo[1,2-a]pyridin-7-amine |
| SMILES | Cc1ccc(Nc2ccn3c(I)cnc3c2F)c(F)c1 |
| InChI | InChI=1S/C14H10F2IN3/c1-8-2-3-10(9(15)6-8)19-11-4-5-20-12(17)7-18-14(20)13(11)16/h2-7,19H,1H3 |
| InChIKey | OEZDOSUDGYJLBG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.16 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|