C12H10F2N2O — CID 143806454
3-fluoro-4-(2-fluoro-4-methylanilino)-1H-pyridin-2-one (PubChem CID 143806454) has the molecular formula C12H10F2N2O and a molecular weight of 236.22 g/mol. Its IUPAC name is 3-fluoro-4-(2-fluoro-4-methylanilino)-1H-pyridin-2-one.
| Compound Name | 3-fluoro-4-(2-fluoro-4-methylanilino)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 143806454 |
| Molecular Formula | C12H10F2N2O |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 3-fluoro-4-(2-fluoro-4-methylanilino)-1H-pyridin-2-one |
| SMILES | Cc1ccc(Nc2cc[nH]c(=O)c2F)c(F)c1 |
| InChI | InChI=1S/C12H10F2N2O/c1-7-2-3-9(8(13)6-7)16-10-4-5-15-12(17)11(10)14/h2-6H,1H3,(H2,15,16,17) |
| InChIKey | QOOWJUDJDVTVGH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |